C24H26N2O3 — CID 10453002
N-(4-butylphenyl)-6-(2,4-dimethoxyphenyl)pyridine-3-carboxamide (PubChem CID 10453002) has the molecular formula C24H26N2O3 and a molecular weight of 390.48 g/mol. Its IUPAC name is N-(4-butylphenyl)-6-(2,4-dimethoxyphenyl)pyridine-3-carboxamide.
| Compound Name | N-(4-butylphenyl)-6-(2,4-dimethoxyphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 10453002 |
| Molecular Formula | C24H26N2O3 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | N-(4-butylphenyl)-6-(2,4-dimethoxyphenyl)pyridine-3-carboxamide |
| SMILES | CCCCc1ccc(NC(=O)c2ccc(-c3ccc(OC)cc3OC)nc2)cc1 |
| InChI | InChI=1S/C24H26N2O3/c1-4-5-6-17-7-10-19(11-8-17)26-24(27)18-9-14-22(25-16-18)21-13-12-20(28-2)15-23(21)29-3/h7-16H,4-6H2,1-3H3,(H,26,27) |
| InChIKey | WBZGOWWCBKOYGB-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |