C20H20ClNO2S — CID 19225588
N-(4-butylphenyl)-3-chloro-5-methoxy-1-benzothiophene-2-carboxamide (PubChem CID 19225588) has the molecular formula C20H20ClNO2S and a molecular weight of 373.91 g/mol. Its IUPAC name is N-(4-butylphenyl)-3-chloro-5-methoxy-1-benzothiophene-2-carboxamide.
| Compound Name | N-(4-butylphenyl)-3-chloro-5-methoxy-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 19225588 |
| Molecular Formula | C20H20ClNO2S |
| Molecular Weight | 373.91 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | N-(4-butylphenyl)-3-chloro-5-methoxy-1-benzothiophene-2-carboxamide |
| SMILES | CCCCc1ccc(NC(=O)c2sc3ccc(OC)cc3c2Cl)cc1 |
| InChI | InChI=1S/C20H20ClNO2S/c1-3-4-5-13-6-8-14(9-7-13)22-20(23)19-18(21)16-12-15(24-2)10-11-17(16)25-19/h6-12H,3-5H2,1-2H3,(H,22,23) |
| InChIKey | VVPYPRKILKOWDZ-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.91 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |