C20H20ClNO3S — CID 19225604
N-(2-butoxyphenyl)-3-chloro-5-methoxy-1-benzothiophene-2-carboxamide (PubChem CID 19225604) has the molecular formula C20H20ClNO3S and a molecular weight of 389.90 g/mol. Its IUPAC name is N-(2-butoxyphenyl)-3-chloro-5-methoxy-1-benzothiophene-2-carboxamide.
| Compound Name | N-(2-butoxyphenyl)-3-chloro-5-methoxy-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 19225604 |
| Molecular Formula | C20H20ClNO3S |
| Molecular Weight | 389.90 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | N-(2-butoxyphenyl)-3-chloro-5-methoxy-1-benzothiophene-2-carboxamide |
| SMILES | CCCCOc1ccccc1NC(=O)c1sc2ccc(OC)cc2c1Cl |
| InChI | InChI=1S/C20H20ClNO3S/c1-3-4-11-25-16-8-6-5-7-15(16)22-20(23)19-18(21)14-12-13(24-2)9-10-17(14)26-19/h5-10,12H,3-4,11H2,1-2H3,(H,22,23) |
| InChIKey | WURZRFZAJMSHTF-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.90 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|