C17H13Cl2NO3S — CID 19225752
3-chloro-N-(5-chloro-2-methoxyphenyl)-5-methoxy-1-benzothiophene-2-carboxamide (PubChem CID 19225752) has the molecular formula C17H13Cl2NO3S and a molecular weight of 382.27 g/mol. Its IUPAC name is 3-chloro-N-(5-chloro-2-methoxyphenyl)-5-methoxy-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-(5-chloro-2-methoxyphenyl)-5-methoxy-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 19225752 |
| Molecular Formula | C17H13Cl2NO3S |
| Molecular Weight | 382.27 g/mol |
| Exact Mass | 381.00 |
| IUPAC Name | 3-chloro-N-(5-chloro-2-methoxyphenyl)-5-methoxy-1-benzothiophene-2-carboxamide |
| SMILES | COc1ccc2sc(C(=O)Nc3cc(Cl)ccc3OC)c(Cl)c2c1 |
| InChI | InChI=1S/C17H13Cl2NO3S/c1-22-10-4-6-14-11(8-10)15(19)16(24-14)17(21)20-12-7-9(18)3-5-13(12)23-2/h3-8H,1-2H3,(H,20,21) |
| InChIKey | WEUSEWGKFTXTET-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.27 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |