C17H13ClN2O3S — CID 19225620
N-(4-carbamoylphenyl)-3-chloro-5-methoxy-1-benzothiophene-2-carboxamide (PubChem CID 19225620) has the molecular formula C17H13ClN2O3S and a molecular weight of 360.82 g/mol. Its IUPAC name is N-(4-carbamoylphenyl)-3-chloro-5-methoxy-1-benzothiophene-2-carboxamide.
| Compound Name | N-(4-carbamoylphenyl)-3-chloro-5-methoxy-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 19225620 |
| Molecular Formula | C17H13ClN2O3S |
| Molecular Weight | 360.82 g/mol |
| Exact Mass | 360.03 |
| IUPAC Name | N-(4-carbamoylphenyl)-3-chloro-5-methoxy-1-benzothiophene-2-carboxamide |
| SMILES | COc1ccc2sc(C(=O)Nc3ccc(C(N)=O)cc3)c(Cl)c2c1 |
| InChI | InChI=1S/C17H13ClN2O3S/c1-23-11-6-7-13-12(8-11)14(18)15(24-13)17(22)20-10-4-2-9(3-5-10)16(19)21/h2-8H,1H3,(H2,19,21)(H,20,22) |
| InChIKey | FINSNQWLSNBCGO-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.82 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |