C18H14ClNO4S — CID 4514231
methyl 4-[(3-chloro-6-methoxy-1-benzothiophene-2-carbonyl)amino]benzoate (PubChem CID 4514231) has the molecular formula C18H14ClNO4S and a molecular weight of 375.83 g/mol. Its IUPAC name is methyl 4-[(3-chloro-6-methoxy-1-benzothiophene-2-carbonyl)amino]benzoate.
| Compound Name | methyl 4-[(3-chloro-6-methoxy-1-benzothiophene-2-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 4514231 |
| Molecular Formula | C18H14ClNO4S |
| Molecular Weight | 375.83 g/mol |
| Exact Mass | 375.03 |
| IUPAC Name | methyl 4-[(3-chloro-6-methoxy-1-benzothiophene-2-carbonyl)amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)c2sc3cc(OC)ccc3c2Cl)cc1 |
| InChI | InChI=1S/C18H14ClNO4S/c1-23-12-7-8-13-14(9-12)25-16(15(13)19)17(21)20-11-5-3-10(4-6-11)18(22)24-2/h3-9H,1-2H3,(H,20,21) |
| InChIKey | ZICZFXVXNNQHKN-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.83 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |