C22H23ClN4O4S — CID 56943063
N-[4-[[(3-chloro-6-methoxy-1-benzothiophene-2-carbonyl)amino]carbamoyl]phenyl]-3-(dimethylamino)propanamide (PubChem CID 56943063) has the molecular formula C22H23ClN4O4S and a molecular weight of 474.97 g/mol. Its IUPAC name is N-[4-[[(3-chloro-6-methoxy-1-benzothiophene-2-carbonyl)amino]carbamoyl]phenyl]-3-(dimethylamino)propanamide.
| Compound Name | N-[4-[[(3-chloro-6-methoxy-1-benzothiophene-2-carbonyl)amino]carbamoyl]phenyl]-3-(dimethylamino)propanamide |
|---|---|
| PubChem CID | 56943063 |
| Molecular Formula | C22H23ClN4O4S |
| Molecular Weight | 474.97 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | N-[4-[[(3-chloro-6-methoxy-1-benzothiophene-2-carbonyl)amino]carbamoyl]phenyl]-3-(dimethylamino)propanamide |
| SMILES | COc1ccc2c(Cl)c(C(=O)NNC(=O)c3ccc(NC(=O)CCN(C)C)cc3)sc2c1 |
| InChI | InChI=1S/C22H23ClN4O4S/c1-27(2)11-10-18(28)24-14-6-4-13(5-7-14)21(29)25-26-22(30)20-19(23)16-9-8-15(31-3)12-17(16)32-20/h4-9,12H,10-11H2,1-3H3,(H,24,28)(H,25,29)(H,26,30) |
| InChIKey | XSYISBOYUNFCPV-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.97 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|