C23H23ClN2O5S — CID 56941425
3-chloro-6-methoxy-N'-[4-(oxan-4-ylmethoxy)benzoyl]-1-benzothiophene-2-carbohydrazide (PubChem CID 56941425) has the molecular formula C23H23ClN2O5S and a molecular weight of 474.97 g/mol. Its IUPAC name is 3-chloro-6-methoxy-N'-[4-(oxan-4-ylmethoxy)benzoyl]-1-benzothiophene-2-carbohydrazide.
| Compound Name | 3-chloro-6-methoxy-N'-[4-(oxan-4-ylmethoxy)benzoyl]-1-benzothiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 56941425 |
| Molecular Formula | C23H23ClN2O5S |
| Molecular Weight | 474.97 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | 3-chloro-6-methoxy-N'-[4-(oxan-4-ylmethoxy)benzoyl]-1-benzothiophene-2-carbohydrazide |
| SMILES | COc1ccc2c(Cl)c(C(=O)NNC(=O)c3ccc(OCC4CCOCC4)cc3)sc2c1 |
| InChI | InChI=1S/C23H23ClN2O5S/c1-29-17-6-7-18-19(12-17)32-21(20(18)24)23(28)26-25-22(27)15-2-4-16(5-3-15)31-13-14-8-10-30-11-9-14/h2-7,12,14H,8-11,13H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | ZRHGTFYOUUZNBL-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.97 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|