C15H11ClN2O3S2 — CID 1013841
3-chloro-6-methoxy-N'-(thiophene-2-carbonyl)-1-benzothiophene-2-carbohydrazide (PubChem CID 1013841) has the molecular formula C15H11ClN2O3S2 and a molecular weight of 366.85 g/mol. Its IUPAC name is 3-chloro-6-methoxy-N'-(thiophene-2-carbonyl)-1-benzothiophene-2-carbohydrazide.
| Compound Name | 3-chloro-6-methoxy-N'-(thiophene-2-carbonyl)-1-benzothiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 1013841 |
| Molecular Formula | C15H11ClN2O3S2 |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 365.99 |
| IUPAC Name | 3-chloro-6-methoxy-N'-(thiophene-2-carbonyl)-1-benzothiophene-2-carbohydrazide |
| SMILES | COc1ccc2c(Cl)c(C(=O)NNC(=O)c3cccs3)sc2c1 |
| InChI | InChI=1S/C15H11ClN2O3S2/c1-21-8-4-5-9-11(7-8)23-13(12(9)16)15(20)18-17-14(19)10-3-2-6-22-10/h2-7H,1H3,(H,17,19)(H,18,20) |
| InChIKey | MQINTDWESPFOQU-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|