C19H15Cl3N2O4S — CID 3432281
3-chloro-N'-[2-(2,4-dichlorophenoxy)propanoyl]-6-methoxy-1-benzothiophene-2-carbohydrazide (PubChem CID 3432281) has the molecular formula C19H15Cl3N2O4S and a molecular weight of 473.77 g/mol. Its IUPAC name is 3-chloro-N'-[2-(2,4-dichlorophenoxy)propanoyl]-6-methoxy-1-benzothiophene-2-carbohydrazide.
| Compound Name | 3-chloro-N'-[2-(2,4-dichlorophenoxy)propanoyl]-6-methoxy-1-benzothiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 3432281 |
| Molecular Formula | C19H15Cl3N2O4S |
| Molecular Weight | 473.77 g/mol |
| Exact Mass | 471.98 |
| IUPAC Name | 3-chloro-N'-[2-(2,4-dichlorophenoxy)propanoyl]-6-methoxy-1-benzothiophene-2-carbohydrazide |
| SMILES | COc1ccc2c(Cl)c(C(=O)NNC(=O)C(C)Oc3ccc(Cl)cc3Cl)sc2c1 |
| InChI | InChI=1S/C19H15Cl3N2O4S/c1-9(28-14-6-3-10(20)7-13(14)21)18(25)23-24-19(26)17-16(22)12-5-4-11(27-2)8-15(12)29-17/h3-9H,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | NMGLLKBIIMLADC-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.77 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|