C15H13ClN4O3S — CID 3321461
N'-(3-chloro-6-methoxy-1-benzothiophene-2-carbonyl)-5-methyl-1H-pyrazole-3-carbohydrazide (PubChem CID 3321461) has the molecular formula C15H13ClN4O3S and a molecular weight of 364.81 g/mol. Its IUPAC name is N'-(3-chloro-6-methoxy-1-benzothiophene-2-carbonyl)-5-methyl-1H-pyrazole-3-carbohydrazide.
| Compound Name | N'-(3-chloro-6-methoxy-1-benzothiophene-2-carbonyl)-5-methyl-1H-pyrazole-3-carbohydrazide |
|---|---|
| PubChem CID | 3321461 |
| Molecular Formula | C15H13ClN4O3S |
| Molecular Weight | 364.81 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | N'-(3-chloro-6-methoxy-1-benzothiophene-2-carbonyl)-5-methyl-1H-pyrazole-3-carbohydrazide |
| SMILES | COc1ccc2c(Cl)c(C(=O)NNC(=O)c3cc(C)[nH]n3)sc2c1 |
| InChI | InChI=1S/C15H13ClN4O3S/c1-7-5-10(18-17-7)14(21)19-20-15(22)13-12(16)9-4-3-8(23-2)6-11(9)24-13/h3-6H,1-2H3,(H,17,18)(H,19,21)(H,20,22) |
| InChIKey | ZOJCKEHAKUIMJF-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.81 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|