C27H24ClN3O7S — CID 71656771
N-[4-[[(3-chloro-5,6-dimethoxy-1-benzothiophene-2-carbonyl)amino]carbamoyl]phenyl]-3,4-dimethoxybenzamide (PubChem CID 71656771) has the molecular formula C27H24ClN3O7S and a molecular weight of 570.02 g/mol. Its IUPAC name is N-[4-[[(3-chloro-5,6-dimethoxy-1-benzothiophene-2-carbonyl)amino]carbamoyl]phenyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[4-[[(3-chloro-5,6-dimethoxy-1-benzothiophene-2-carbonyl)amino]carbamoyl]phenyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 71656771 |
| Molecular Formula | C27H24ClN3O7S |
| Molecular Weight | 570.02 g/mol |
| Exact Mass | 569.10 |
| IUPAC Name | N-[4-[[(3-chloro-5,6-dimethoxy-1-benzothiophene-2-carbonyl)amino]carbamoyl]phenyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(C(=O)NNC(=O)c3sc4cc(OC)c(OC)cc4c3Cl)cc2)cc1OC |
| InChI | InChI=1S/C27H24ClN3O7S/c1-35-18-10-7-15(11-19(18)36-2)25(32)29-16-8-5-14(6-9-16)26(33)30-31-27(34)24-23(28)17-12-20(37-3)21(38-4)13-22(17)39-24/h5-13H,1-4H3,(H,29,32)(H,30,33)(H,31,34) |
| InChIKey | UADSDWYTTURVFM-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 124.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.02 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|