C25H22ClN3O4S — CID 174675332
N-[4-[2-(3-chloro-5,6-dimethoxy-1-benzothiophene-2-carbonyl)hydrazinyl]phenyl]-4-methylbenzamide (PubChem CID 174675332) has the molecular formula C25H22ClN3O4S and a molecular weight of 495.99 g/mol. Its IUPAC name is N-[4-[2-(3-chloro-5,6-dimethoxy-1-benzothiophene-2-carbonyl)hydrazinyl]phenyl]-4-methylbenzamide.
| Compound Name | N-[4-[2-(3-chloro-5,6-dimethoxy-1-benzothiophene-2-carbonyl)hydrazinyl]phenyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 174675332 |
| Molecular Formula | C25H22ClN3O4S |
| Molecular Weight | 495.99 g/mol |
| Exact Mass | 495.10 |
| IUPAC Name | N-[4-[2-(3-chloro-5,6-dimethoxy-1-benzothiophene-2-carbonyl)hydrazinyl]phenyl]-4-methylbenzamide |
| SMILES | COc1cc2sc(C(=O)NNc3ccc(NC(=O)c4ccc(C)cc4)cc3)c(Cl)c2cc1OC |
| InChI | InChI=1S/C25H22ClN3O4S/c1-14-4-6-15(7-5-14)24(30)27-16-8-10-17(11-9-16)28-29-25(31)23-22(26)18-12-19(32-2)20(33-3)13-21(18)34-23/h4-13,28H,1-3H3,(H,27,30)(H,29,31) |
| InChIKey | GUIIQGFRGNXGOG-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.99 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|