C25H19Cl2N3O5S — CID 71657141
N-[4-[[(3,6-dichloro-1-benzothiophene-2-carbonyl)amino]carbamoyl]phenyl]-3,4-dimethoxybenzamide (PubChem CID 71657141) has the molecular formula C25H19Cl2N3O5S and a molecular weight of 544.42 g/mol. Its IUPAC name is N-[4-[[(3,6-dichloro-1-benzothiophene-2-carbonyl)amino]carbamoyl]phenyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[4-[[(3,6-dichloro-1-benzothiophene-2-carbonyl)amino]carbamoyl]phenyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 71657141 |
| Molecular Formula | C25H19Cl2N3O5S |
| Molecular Weight | 544.42 g/mol |
| Exact Mass | 543.04 |
| IUPAC Name | N-[4-[[(3,6-dichloro-1-benzothiophene-2-carbonyl)amino]carbamoyl]phenyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(C(=O)NNC(=O)c3sc4cc(Cl)ccc4c3Cl)cc2)cc1OC |
| InChI | InChI=1S/C25H19Cl2N3O5S/c1-34-18-10-5-14(11-19(18)35-2)23(31)28-16-7-3-13(4-8-16)24(32)29-30-25(33)22-21(27)17-9-6-15(26)12-20(17)36-22/h3-12H,1-2H3,(H,28,31)(H,29,32)(H,30,33) |
| InChIKey | NTQGWLBHEKHOQC-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.42 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|