C18H13Cl2NO3S — CID 4237522
ethyl 4-[(3,6-dichloro-1-benzothiophene-2-carbonyl)amino]benzoate (PubChem CID 4237522) has the molecular formula C18H13Cl2NO3S and a molecular weight of 394.28 g/mol. Its IUPAC name is ethyl 4-[(3,6-dichloro-1-benzothiophene-2-carbonyl)amino]benzoate.
| Compound Name | ethyl 4-[(3,6-dichloro-1-benzothiophene-2-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 4237522 |
| Molecular Formula | C18H13Cl2NO3S |
| Molecular Weight | 394.28 g/mol |
| Exact Mass | 393.00 |
| IUPAC Name | ethyl 4-[(3,6-dichloro-1-benzothiophene-2-carbonyl)amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)c2sc3cc(Cl)ccc3c2Cl)cc1 |
| InChI | InChI=1S/C18H13Cl2NO3S/c1-2-24-18(23)10-3-6-12(7-4-10)21-17(22)16-15(20)13-8-5-11(19)9-14(13)25-16/h3-9H,2H2,1H3,(H,21,22) |
| InChIKey | ZFTKJYPUGZFGAP-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.28 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |