C24H18ClNO5S — CID 19225805
[4-[(4-methoxyphenyl)carbamoyl]phenyl] 3-chloro-5-methoxy-1-benzothiophene-2-carboxylate (PubChem CID 19225805) has the molecular formula C24H18ClNO5S and a molecular weight of 467.93 g/mol. Its IUPAC name is [4-[(4-methoxyphenyl)carbamoyl]phenyl] 3-chloro-5-methoxy-1-benzothiophene-2-carboxylate.
| Compound Name | [4-[(4-methoxyphenyl)carbamoyl]phenyl] 3-chloro-5-methoxy-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 19225805 |
| Molecular Formula | C24H18ClNO5S |
| Molecular Weight | 467.93 g/mol |
| Exact Mass | 467.06 |
| IUPAC Name | [4-[(4-methoxyphenyl)carbamoyl]phenyl] 3-chloro-5-methoxy-1-benzothiophene-2-carboxylate |
| SMILES | COc1ccc(NC(=O)c2ccc(OC(=O)c3sc4ccc(OC)cc4c3Cl)cc2)cc1 |
| InChI | InChI=1S/C24H18ClNO5S/c1-29-16-9-5-15(6-10-16)26-23(27)14-3-7-17(8-4-14)31-24(28)22-21(25)19-13-18(30-2)11-12-20(19)32-22/h3-13H,1-2H3,(H,26,27) |
| InChIKey | VPFCFULALSCKTL-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.93 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|