C26H20ClNO4S — CID 11784869
3-chloro-N-[4-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]phenyl]-1-benzothiophene-2-carboxamide (PubChem CID 11784869) has the molecular formula C26H20ClNO4S and a molecular weight of 477.97 g/mol. Its IUPAC name is 3-chloro-N-[4-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]phenyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[4-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]phenyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 11784869 |
| Molecular Formula | C26H20ClNO4S |
| Molecular Weight | 477.97 g/mol |
| Exact Mass | 477.08 |
| IUPAC Name | 3-chloro-N-[4-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]phenyl]-1-benzothiophene-2-carboxamide |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc(NC(=O)c3sc4ccccc4c3Cl)cc2)cc1OC |
| InChI | InChI=1S/C26H20ClNO4S/c1-31-21-14-8-16(15-22(21)32-2)7-13-20(29)17-9-11-18(12-10-17)28-26(30)25-24(27)19-5-3-4-6-23(19)33-25/h3-15H,1-2H3,(H,28,30)/b13-7+ |
| InChIKey | PBQDFCLZFSSZKH-NTUHNPAUSA-N |
| XLogP | 6.72 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.97 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|