C34H30N2O5 — CID 23094587
N-[(Z)-3-[4-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]anilino]-1-(4-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 23094587) has the molecular formula C34H30N2O5 and a molecular weight of 546.62 g/mol. Its IUPAC name is N-[(Z)-3-[4-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]anilino]-1-(4-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]anilino]-1-(4-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 23094587 |
| Molecular Formula | C34H30N2O5 |
| Molecular Weight | 546.62 g/mol |
| Exact Mass | 546.22 |
| IUPAC Name | N-[(Z)-3-[4-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]anilino]-1-(4-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc(NC(=O)/C(=C/c3ccc(C)cc3)NC(=O)c3ccccc3)cc2)cc1OC |
| InChI | InChI=1S/C34H30N2O5/c1-23-9-11-24(12-10-23)21-29(36-33(38)27-7-5-4-6-8-27)34(39)35-28-17-15-26(16-18-28)30(37)19-13-25-14-20-31(40-2)32(22-25)41-3/h4-22H,1-3H3,(H,35,39)(H,36,38)/b19-13+,29-21- |
| InChIKey | LGCDHWAPUQVYED-FDKTUKQMSA-N |
| XLogP | 6.32 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.62 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|