C35H32N2O7 — CID 22787372
N-[(Z)-1-(4-methoxyphenyl)-3-oxo-3-[4-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]anilino]prop-1-en-2-yl]benzamide (PubChem CID 22787372) has the molecular formula C35H32N2O7 and a molecular weight of 592.65 g/mol. Its IUPAC name is N-[(Z)-1-(4-methoxyphenyl)-3-oxo-3-[4-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]anilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(4-methoxyphenyl)-3-oxo-3-[4-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]anilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22787372 |
| Molecular Formula | C35H32N2O7 |
| Molecular Weight | 592.65 g/mol |
| Exact Mass | 592.22 |
| IUPAC Name | N-[(Z)-1-(4-methoxyphenyl)-3-oxo-3-[4-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]anilino]prop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(/C=C(\NC(=O)c2ccccc2)C(=O)Nc2ccc(C(=O)/C=C/c3cc(OC)c(OC)c(OC)c3)cc2)cc1 |
| InChI | InChI=1S/C35H32N2O7/c1-41-28-17-10-23(11-18-28)20-29(37-34(39)26-8-6-5-7-9-26)35(40)36-27-15-13-25(14-16-27)30(38)19-12-24-21-31(42-2)33(44-4)32(22-24)43-3/h5-22H,1-4H3,(H,36,40)(H,37,39)/b19-12+,29-20- |
| InChIKey | PEAREVYRXFDXSW-RXMKDHGPSA-N |
| XLogP | 6.03 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.65 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|