C32H28N2O6S — CID 22787779
N-[(Z)-3-oxo-1-thiophen-3-yl-3-[4-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]anilino]prop-1-en-2-yl]benzamide (PubChem CID 22787779) has the molecular formula C32H28N2O6S and a molecular weight of 568.65 g/mol. Its IUPAC name is N-[(Z)-3-oxo-1-thiophen-3-yl-3-[4-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]anilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-oxo-1-thiophen-3-yl-3-[4-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]anilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22787779 |
| Molecular Formula | C32H28N2O6S |
| Molecular Weight | 568.65 g/mol |
| Exact Mass | 568.17 |
| IUPAC Name | N-[(Z)-3-oxo-1-thiophen-3-yl-3-[4-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]anilino]prop-1-en-2-yl]benzamide |
| SMILES | COc1cc(/C=C/C(=O)c2ccc(NC(=O)/C(=C/c3ccsc3)NC(=O)c3ccccc3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C32H28N2O6S/c1-38-28-18-21(19-29(39-2)30(28)40-3)9-14-27(35)23-10-12-25(13-11-23)33-32(37)26(17-22-15-16-41-20-22)34-31(36)24-7-5-4-6-8-24/h4-20H,1-3H3,(H,33,37)(H,34,36)/b14-9+,26-17- |
| InChIKey | SGTHPMVAZSPYOS-AYSARKQPSA-N |
| XLogP | 6.08 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.65 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|