C36H28N2O4S — CID 23094711
N-[(Z)-3-oxo-1-(4-phenylmethoxyphenyl)-3-[4-[(E)-3-thiophen-3-ylprop-2-enoyl]anilino]prop-1-en-2-yl]benzamide (PubChem CID 23094711) has the molecular formula C36H28N2O4S and a molecular weight of 584.70 g/mol. Its IUPAC name is N-[(Z)-3-oxo-1-(4-phenylmethoxyphenyl)-3-[4-[(E)-3-thiophen-3-ylprop-2-enoyl]anilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-oxo-1-(4-phenylmethoxyphenyl)-3-[4-[(E)-3-thiophen-3-ylprop-2-enoyl]anilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 23094711 |
| Molecular Formula | C36H28N2O4S |
| Molecular Weight | 584.70 g/mol |
| Exact Mass | 584.18 |
| IUPAC Name | N-[(Z)-3-oxo-1-(4-phenylmethoxyphenyl)-3-[4-[(E)-3-thiophen-3-ylprop-2-enoyl]anilino]prop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1ccc(C(=O)/C=C/c2ccsc2)cc1)/C(=C/c1ccc(OCc2ccccc2)cc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C36H28N2O4S/c39-34(20-13-28-21-22-43-25-28)29-14-16-31(17-15-29)37-36(41)33(38-35(40)30-9-5-2-6-10-30)23-26-11-18-32(19-12-26)42-24-27-7-3-1-4-8-27/h1-23,25H,24H2,(H,37,41)(H,38,40)/b20-13+,33-23- |
| InChIKey | QLGABXVRNCIZCP-GPDFZHTOSA-N |
| XLogP | 7.63 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.70 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|