C29H20Cl2N2O3S — CID 22787105
N-[(Z)-1-(2,4-dichlorophenyl)-3-oxo-3-[4-[(E)-3-thiophen-3-ylprop-2-enoyl]anilino]prop-1-en-2-yl]benzamide (PubChem CID 22787105) has the molecular formula C29H20Cl2N2O3S and a molecular weight of 547.46 g/mol. Its IUPAC name is N-[(Z)-1-(2,4-dichlorophenyl)-3-oxo-3-[4-[(E)-3-thiophen-3-ylprop-2-enoyl]anilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(2,4-dichlorophenyl)-3-oxo-3-[4-[(E)-3-thiophen-3-ylprop-2-enoyl]anilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22787105 |
| Molecular Formula | C29H20Cl2N2O3S |
| Molecular Weight | 547.46 g/mol |
| Exact Mass | 546.06 |
| IUPAC Name | N-[(Z)-1-(2,4-dichlorophenyl)-3-oxo-3-[4-[(E)-3-thiophen-3-ylprop-2-enoyl]anilino]prop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1ccc(C(=O)/C=C/c2ccsc2)cc1)/C(=C/c1ccc(Cl)cc1Cl)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C29H20Cl2N2O3S/c30-23-10-7-22(25(31)17-23)16-26(33-28(35)21-4-2-1-3-5-21)29(36)32-24-11-8-20(9-12-24)27(34)13-6-19-14-15-37-18-19/h1-18H,(H,32,36)(H,33,35)/b13-6+,26-16- |
| InChIKey | NMLYKNQMNAIUPI-FJWXOVFBSA-N |
| XLogP | 7.36 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.46 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|