C31H22ClN3O5 — CID 22786919
N-[(Z)-1-(2-chlorophenyl)-3-[4-[(E)-3-(4-nitrophenyl)prop-2-enoyl]anilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 22786919) has the molecular formula C31H22ClN3O5 and a molecular weight of 551.99 g/mol. Its IUPAC name is N-[(Z)-1-(2-chlorophenyl)-3-[4-[(E)-3-(4-nitrophenyl)prop-2-enoyl]anilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(2-chlorophenyl)-3-[4-[(E)-3-(4-nitrophenyl)prop-2-enoyl]anilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22786919 |
| Molecular Formula | C31H22ClN3O5 |
| Molecular Weight | 551.99 g/mol |
| Exact Mass | 551.12 |
| IUPAC Name | N-[(Z)-1-(2-chlorophenyl)-3-[4-[(E)-3-(4-nitrophenyl)prop-2-enoyl]anilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1ccc(C(=O)/C=C/c2ccc([N+](=O)[O-])cc2)cc1)/C(=C/c1ccccc1Cl)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C31H22ClN3O5/c32-27-9-5-4-8-24(27)20-28(34-30(37)23-6-2-1-3-7-23)31(38)33-25-15-13-22(14-16-25)29(36)19-12-21-10-17-26(18-11-21)35(39)40/h1-20H,(H,33,38)(H,34,37)/b19-12+,28-20- |
| InChIKey | IMNKETFTRHOQEO-WFIQJISDSA-N |
| XLogP | 6.55 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.99 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|