C33H27N3O6 — CID 22787474
N-[(Z)-1-(2-ethoxyphenyl)-3-[4-[(E)-3-(4-nitrophenyl)prop-2-enoyl]anilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 22787474) has the molecular formula C33H27N3O6 and a molecular weight of 561.59 g/mol. Its IUPAC name is N-[(Z)-1-(2-ethoxyphenyl)-3-[4-[(E)-3-(4-nitrophenyl)prop-2-enoyl]anilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(2-ethoxyphenyl)-3-[4-[(E)-3-(4-nitrophenyl)prop-2-enoyl]anilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22787474 |
| Molecular Formula | C33H27N3O6 |
| Molecular Weight | 561.59 g/mol |
| Exact Mass | 561.19 |
| IUPAC Name | N-[(Z)-1-(2-ethoxyphenyl)-3-[4-[(E)-3-(4-nitrophenyl)prop-2-enoyl]anilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCOc1ccccc1/C=C(\NC(=O)c1ccccc1)C(=O)Nc1ccc(C(=O)/C=C/c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C33H27N3O6/c1-2-42-31-11-7-6-10-26(31)22-29(35-32(38)25-8-4-3-5-9-25)33(39)34-27-17-15-24(16-18-27)30(37)21-14-23-12-19-28(20-13-23)36(40)41/h3-22H,2H2,1H3,(H,34,39)(H,35,38)/b21-14+,29-22- |
| InChIKey | QUKQPLUPNPEMOU-ITBLNYAJSA-N |
| XLogP | 6.30 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.59 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|