C33H27N3O7 — CID 22787720
N-[(Z)-3-[4-[(E)-3-(2,5-dimethoxyphenyl)prop-2-enoyl]anilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 22787720) has the molecular formula C33H27N3O7 and a molecular weight of 577.59 g/mol. Its IUPAC name is N-[(Z)-3-[4-[(E)-3-(2,5-dimethoxyphenyl)prop-2-enoyl]anilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[(E)-3-(2,5-dimethoxyphenyl)prop-2-enoyl]anilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22787720 |
| Molecular Formula | C33H27N3O7 |
| Molecular Weight | 577.59 g/mol |
| Exact Mass | 577.18 |
| IUPAC Name | N-[(Z)-3-[4-[(E)-3-(2,5-dimethoxyphenyl)prop-2-enoyl]anilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(OC)c(/C=C/C(=O)c2ccc(NC(=O)/C(=C/c3ccc([N+](=O)[O-])cc3)NC(=O)c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C33H27N3O7/c1-42-28-17-19-31(43-2)25(21-28)12-18-30(37)23-10-13-26(14-11-23)34-33(39)29(35-32(38)24-6-4-3-5-7-24)20-22-8-15-27(16-9-22)36(40)41/h3-21H,1-2H3,(H,34,39)(H,35,38)/b18-12+,29-20- |
| InChIKey | YIXHKGRTAPZSEU-LMQMHXRRSA-N |
| XLogP | 5.92 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.59 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|