C31H21Cl2N3O5 — CID 22787716
N-[(Z)-3-[4-[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]anilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 22787716) has the molecular formula C31H21Cl2N3O5 and a molecular weight of 586.43 g/mol. Its IUPAC name is N-[(Z)-3-[4-[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]anilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]anilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22787716 |
| Molecular Formula | C31H21Cl2N3O5 |
| Molecular Weight | 586.43 g/mol |
| Exact Mass | 585.09 |
| IUPAC Name | N-[(Z)-3-[4-[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]anilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1ccc(C(=O)/C=C/c2ccc(Cl)cc2Cl)cc1)/C(=C/c1ccc([N+](=O)[O-])cc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C31H21Cl2N3O5/c32-24-12-8-21(27(33)19-24)11-17-29(37)22-9-13-25(14-10-22)34-31(39)28(35-30(38)23-4-2-1-3-5-23)18-20-6-15-26(16-7-20)36(40)41/h1-19H,(H,34,39)(H,35,38)/b17-11+,28-18- |
| InChIKey | CDGZJTAFVCWBNZ-NMEUUQBQSA-N |
| XLogP | 7.21 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.43 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|