C33H28N2O4 — CID 22787368
N-[(Z)-1-(4-methoxyphenyl)-3-[4-[(E)-3-(2-methylphenyl)prop-2-enoyl]anilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 22787368) has the molecular formula C33H28N2O4 and a molecular weight of 516.60 g/mol. Its IUPAC name is N-[(Z)-1-(4-methoxyphenyl)-3-[4-[(E)-3-(2-methylphenyl)prop-2-enoyl]anilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(4-methoxyphenyl)-3-[4-[(E)-3-(2-methylphenyl)prop-2-enoyl]anilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22787368 |
| Molecular Formula | C33H28N2O4 |
| Molecular Weight | 516.60 g/mol |
| Exact Mass | 516.20 |
| IUPAC Name | N-[(Z)-1-(4-methoxyphenyl)-3-[4-[(E)-3-(2-methylphenyl)prop-2-enoyl]anilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(/C=C(\NC(=O)c2ccccc2)C(=O)Nc2ccc(C(=O)/C=C/c3ccccc3C)cc2)cc1 |
| InChI | InChI=1S/C33H28N2O4/c1-23-8-6-7-9-25(23)16-21-31(36)26-14-17-28(18-15-26)34-33(38)30(22-24-12-19-29(39-2)20-13-24)35-32(37)27-10-4-3-5-11-27/h3-22H,1-2H3,(H,34,38)(H,35,37)/b21-16+,30-22- |
| InChIKey | OHDQWTJHXPIZMB-GCZBLHPPSA-N |
| XLogP | 6.31 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.60 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|