C35H32N2O6 — CID 22787172
N-[(Z)-1-(2,3-dimethoxyphenyl)-3-[4-[(E)-3-(4-ethoxyphenyl)prop-2-enoyl]anilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 22787172) has the molecular formula C35H32N2O6 and a molecular weight of 576.65 g/mol. Its IUPAC name is N-[(Z)-1-(2,3-dimethoxyphenyl)-3-[4-[(E)-3-(4-ethoxyphenyl)prop-2-enoyl]anilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(2,3-dimethoxyphenyl)-3-[4-[(E)-3-(4-ethoxyphenyl)prop-2-enoyl]anilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22787172 |
| Molecular Formula | C35H32N2O6 |
| Molecular Weight | 576.65 g/mol |
| Exact Mass | 576.23 |
| IUPAC Name | N-[(Z)-1-(2,3-dimethoxyphenyl)-3-[4-[(E)-3-(4-ethoxyphenyl)prop-2-enoyl]anilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCOc1ccc(/C=C/C(=O)c2ccc(NC(=O)/C(=C/c3cccc(OC)c3OC)NC(=O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C35H32N2O6/c1-4-43-29-20-13-24(14-21-29)15-22-31(38)25-16-18-28(19-17-25)36-35(40)30(37-34(39)26-9-6-5-7-10-26)23-27-11-8-12-32(41-2)33(27)42-3/h5-23H,4H2,1-3H3,(H,36,40)(H,37,39)/b22-15+,30-23- |
| InChIKey | GZFBOOZYPXJBDS-QBFWYIETSA-N |
| XLogP | 6.41 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.65 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|