C35H33N3O5 — CID 22787311
N-[(Z)-3-[4-[(E)-3-(2,3-dimethoxyphenyl)prop-2-enoyl]anilino]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 22787311) has the molecular formula C35H33N3O5 and a molecular weight of 575.67 g/mol. Its IUPAC name is N-[(Z)-3-[4-[(E)-3-(2,3-dimethoxyphenyl)prop-2-enoyl]anilino]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[(E)-3-(2,3-dimethoxyphenyl)prop-2-enoyl]anilino]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22787311 |
| Molecular Formula | C35H33N3O5 |
| Molecular Weight | 575.67 g/mol |
| Exact Mass | 575.24 |
| IUPAC Name | N-[(Z)-3-[4-[(E)-3-(2,3-dimethoxyphenyl)prop-2-enoyl]anilino]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1cccc(/C=C/C(=O)c2ccc(NC(=O)/C(=C/c3ccc(N(C)C)cc3)NC(=O)c3ccccc3)cc2)c1OC |
| InChI | InChI=1S/C35H33N3O5/c1-38(2)29-20-13-24(14-21-29)23-30(37-34(40)27-9-6-5-7-10-27)35(41)36-28-18-15-25(16-19-28)31(39)22-17-26-11-8-12-32(42-3)33(26)43-4/h5-23H,1-4H3,(H,36,41)(H,37,40)/b22-17+,30-23- |
| InChIKey | UDQLOPINPMPOAO-MXHMNEIUSA-N |
| XLogP | 6.08 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.67 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|