C33H27ClN2O5 — CID 22786941
N-[(Z)-1-(3-chlorophenyl)-3-[4-[(E)-3-(2,3-dimethoxyphenyl)prop-2-enoyl]anilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 22786941) has the molecular formula C33H27ClN2O5 and a molecular weight of 567.04 g/mol. Its IUPAC name is N-[(Z)-1-(3-chlorophenyl)-3-[4-[(E)-3-(2,3-dimethoxyphenyl)prop-2-enoyl]anilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(3-chlorophenyl)-3-[4-[(E)-3-(2,3-dimethoxyphenyl)prop-2-enoyl]anilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22786941 |
| Molecular Formula | C33H27ClN2O5 |
| Molecular Weight | 567.04 g/mol |
| Exact Mass | 566.16 |
| IUPAC Name | N-[(Z)-1-(3-chlorophenyl)-3-[4-[(E)-3-(2,3-dimethoxyphenyl)prop-2-enoyl]anilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1cccc(/C=C/C(=O)c2ccc(NC(=O)/C(=C/c3cccc(Cl)c3)NC(=O)c3ccccc3)cc2)c1OC |
| InChI | InChI=1S/C33H27ClN2O5/c1-40-30-13-7-11-24(31(30)41-2)16-19-29(37)23-14-17-27(18-15-23)35-33(39)28(21-22-8-6-12-26(34)20-22)36-32(38)25-9-4-3-5-10-25/h3-21H,1-2H3,(H,35,39)(H,36,38)/b19-16+,28-21- |
| InChIKey | AJBGGHYLVBPOMY-IRXVHRNUSA-N |
| XLogP | 6.66 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.04 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|