C33H28N2O5 — CID 22787392
N-[(Z)-1-(2-methoxyphenyl)-3-[4-[(E)-3-(3-methoxyphenyl)prop-2-enoyl]anilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 22787392) has the molecular formula C33H28N2O5 and a molecular weight of 532.60 g/mol. Its IUPAC name is N-[(Z)-1-(2-methoxyphenyl)-3-[4-[(E)-3-(3-methoxyphenyl)prop-2-enoyl]anilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(2-methoxyphenyl)-3-[4-[(E)-3-(3-methoxyphenyl)prop-2-enoyl]anilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22787392 |
| Molecular Formula | C33H28N2O5 |
| Molecular Weight | 532.60 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | N-[(Z)-1-(2-methoxyphenyl)-3-[4-[(E)-3-(3-methoxyphenyl)prop-2-enoyl]anilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1cccc(/C=C/C(=O)c2ccc(NC(=O)/C(=C/c3ccccc3OC)NC(=O)c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C33H28N2O5/c1-39-28-13-8-9-23(21-28)15-20-30(36)24-16-18-27(19-17-24)34-33(38)29(22-26-12-6-7-14-31(26)40-2)35-32(37)25-10-4-3-5-11-25/h3-22H,1-2H3,(H,34,38)(H,35,37)/b20-15+,29-22- |
| InChIKey | LEHAXLDJJAOCQY-AXCLIPECSA-N |
| XLogP | 6.01 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.60 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|