C37H30N2O6 — CID 124653344
N-[(Z)-1-[5-(2-methoxyphenyl)furan-2-yl]-3-[4-[(E)-3-(3-methoxyphenyl)prop-2-enoyl]anilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 124653344) has the molecular formula C37H30N2O6 and a molecular weight of 598.66 g/mol. Its IUPAC name is N-[(Z)-1-[5-(2-methoxyphenyl)furan-2-yl]-3-[4-[(E)-3-(3-methoxyphenyl)prop-2-enoyl]anilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-[5-(2-methoxyphenyl)furan-2-yl]-3-[4-[(E)-3-(3-methoxyphenyl)prop-2-enoyl]anilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 124653344 |
| Molecular Formula | C37H30N2O6 |
| Molecular Weight | 598.66 g/mol |
| Exact Mass | 598.21 |
| IUPAC Name | N-[(Z)-1-[5-(2-methoxyphenyl)furan-2-yl]-3-[4-[(E)-3-(3-methoxyphenyl)prop-2-enoyl]anilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1cccc(/C=C/C(=O)c2ccc(NC(=O)/C(=C/c3ccc(-c4ccccc4OC)o3)NC(=O)c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C37H30N2O6/c1-43-29-12-8-9-25(23-29)15-21-33(40)26-16-18-28(19-17-26)38-37(42)32(39-36(41)27-10-4-3-5-11-27)24-30-20-22-35(45-30)31-13-6-7-14-34(31)44-2/h3-24H,1-2H3,(H,38,42)(H,39,41)/b21-15+,32-24- |
| InChIKey | RORSIPRXOIAIOC-QHCQKCTMSA-N |
| XLogP | 7.27 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.66 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|