C33H26Cl2N2O5 — CID 22787199
N-[(Z)-3-[4-[(E)-3-(2,6-dichlorophenyl)prop-2-enoyl]anilino]-1-(2,4-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 22787199) has the molecular formula C33H26Cl2N2O5 and a molecular weight of 601.49 g/mol. Its IUPAC name is N-[(Z)-3-[4-[(E)-3-(2,6-dichlorophenyl)prop-2-enoyl]anilino]-1-(2,4-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[(E)-3-(2,6-dichlorophenyl)prop-2-enoyl]anilino]-1-(2,4-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22787199 |
| Molecular Formula | C33H26Cl2N2O5 |
| Molecular Weight | 601.49 g/mol |
| Exact Mass | 600.12 |
| IUPAC Name | N-[(Z)-3-[4-[(E)-3-(2,6-dichlorophenyl)prop-2-enoyl]anilino]-1-(2,4-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(/C=C(\NC(=O)c2ccccc2)C(=O)Nc2ccc(C(=O)/C=C/c3c(Cl)cccc3Cl)cc2)c(OC)c1 |
| InChI | InChI=1S/C33H26Cl2N2O5/c1-41-25-16-13-23(31(20-25)42-2)19-29(37-32(39)22-7-4-3-5-8-22)33(40)36-24-14-11-21(12-15-24)30(38)18-17-26-27(34)9-6-10-28(26)35/h3-20H,1-2H3,(H,36,40)(H,37,39)/b18-17+,29-19- |
| InChIKey | YQRZHHQUPHCBFB-GEKCRLMCSA-N |
| XLogP | 7.32 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.49 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|