C32H24Cl2N2O4 — CID 22787131
N-[(Z)-1-(2,6-dichlorophenyl)-3-[4-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]anilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 22787131) has the molecular formula C32H24Cl2N2O4 and a molecular weight of 571.46 g/mol. Its IUPAC name is N-[(Z)-1-(2,6-dichlorophenyl)-3-[4-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]anilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(2,6-dichlorophenyl)-3-[4-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]anilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22787131 |
| Molecular Formula | C32H24Cl2N2O4 |
| Molecular Weight | 571.46 g/mol |
| Exact Mass | 570.11 |
| IUPAC Name | N-[(Z)-1-(2,6-dichlorophenyl)-3-[4-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]anilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc(NC(=O)/C(=C/c3c(Cl)cccc3Cl)NC(=O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C32H24Cl2N2O4/c1-40-25-17-10-21(11-18-25)12-19-30(37)22-13-15-24(16-14-22)35-32(39)29(20-26-27(33)8-5-9-28(26)34)36-31(38)23-6-3-2-4-7-23/h2-20H,1H3,(H,35,39)(H,36,38)/b19-12+,29-20- |
| InChIKey | IERKNBPLPDNIGD-RXMKDHGPSA-N |
| XLogP | 7.31 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.46 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|