C37H26Cl2N2O3 — CID 22787144
N-[(Z)-1-(2,6-dichlorophenyl)-3-oxo-3-[4-[(E)-3-(4-phenylphenyl)prop-2-enoyl]anilino]prop-1-en-2-yl]benzamide (PubChem CID 22787144) has the molecular formula C37H26Cl2N2O3 and a molecular weight of 617.53 g/mol. Its IUPAC name is N-[(Z)-1-(2,6-dichlorophenyl)-3-oxo-3-[4-[(E)-3-(4-phenylphenyl)prop-2-enoyl]anilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(2,6-dichlorophenyl)-3-oxo-3-[4-[(E)-3-(4-phenylphenyl)prop-2-enoyl]anilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22787144 |
| Molecular Formula | C37H26Cl2N2O3 |
| Molecular Weight | 617.53 g/mol |
| Exact Mass | 616.13 |
| IUPAC Name | N-[(Z)-1-(2,6-dichlorophenyl)-3-oxo-3-[4-[(E)-3-(4-phenylphenyl)prop-2-enoyl]anilino]prop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1ccc(C(=O)/C=C/c2ccc(-c3ccccc3)cc2)cc1)/C(=C/c1c(Cl)cccc1Cl)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C37H26Cl2N2O3/c38-32-12-7-13-33(39)31(32)24-34(41-36(43)29-10-5-2-6-11-29)37(44)40-30-21-19-28(20-22-30)35(42)23-16-25-14-17-27(18-15-25)26-8-3-1-4-9-26/h1-24H,(H,40,44)(H,41,43)/b23-16+,34-24- |
| InChIKey | XUZJHMZBSKTYKE-VXTOAPSDSA-N |
| XLogP | 8.97 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.53 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|