C35H25N3O5 — CID 22787696
N-[(Z)-1-naphthalen-1-yl-3-[4-[(E)-3-(4-nitrophenyl)prop-2-enoyl]anilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 22787696) has the molecular formula C35H25N3O5 and a molecular weight of 567.60 g/mol. Its IUPAC name is N-[(Z)-1-naphthalen-1-yl-3-[4-[(E)-3-(4-nitrophenyl)prop-2-enoyl]anilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-naphthalen-1-yl-3-[4-[(E)-3-(4-nitrophenyl)prop-2-enoyl]anilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22787696 |
| Molecular Formula | C35H25N3O5 |
| Molecular Weight | 567.60 g/mol |
| Exact Mass | 567.18 |
| IUPAC Name | N-[(Z)-1-naphthalen-1-yl-3-[4-[(E)-3-(4-nitrophenyl)prop-2-enoyl]anilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1ccc(C(=O)/C=C/c2ccc([N+](=O)[O-])cc2)cc1)/C(=C/c1cccc2ccccc12)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C35H25N3O5/c39-33(22-15-24-13-20-30(21-14-24)38(42)43)26-16-18-29(19-17-26)36-35(41)32(37-34(40)27-8-2-1-3-9-27)23-28-11-6-10-25-7-4-5-12-31(25)28/h1-23H,(H,36,41)(H,37,40)/b22-15+,32-23- |
| InChIKey | LXHQFEKLDPHHEC-MZMMBZOGSA-N |
| XLogP | 7.05 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.60 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|