C18H16ClNO2S — CID 19225626
3-chloro-5-methoxy-N-(2-phenylethyl)-1-benzothiophene-2-carboxamide (PubChem CID 19225626) has the molecular formula C18H16ClNO2S and a molecular weight of 345.85 g/mol. Its IUPAC name is 3-chloro-5-methoxy-N-(2-phenylethyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-5-methoxy-N-(2-phenylethyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 19225626 |
| Molecular Formula | C18H16ClNO2S |
| Molecular Weight | 345.85 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | 3-chloro-5-methoxy-N-(2-phenylethyl)-1-benzothiophene-2-carboxamide |
| SMILES | COc1ccc2sc(C(=O)NCCc3ccccc3)c(Cl)c2c1 |
| InChI | InChI=1S/C18H16ClNO2S/c1-22-13-7-8-15-14(11-13)16(19)17(23-15)18(21)20-10-9-12-5-3-2-4-6-12/h2-8,11H,9-10H2,1H3,(H,20,21) |
| InChIKey | ROLUYRTYEHHLLD-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.85 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |