C19H18ClNOS — CID 4083903
N-(4-butylphenyl)-3-chloro-1-benzothiophene-2-carboxamide (PubChem CID 4083903) has the molecular formula C19H18ClNOS and a molecular weight of 343.88 g/mol. Its IUPAC name is N-(4-butylphenyl)-3-chloro-1-benzothiophene-2-carboxamide.
| Compound Name | N-(4-butylphenyl)-3-chloro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 4083903 |
| Molecular Formula | C19H18ClNOS |
| Molecular Weight | 343.88 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | N-(4-butylphenyl)-3-chloro-1-benzothiophene-2-carboxamide |
| SMILES | CCCCc1ccc(NC(=O)c2sc3ccccc3c2Cl)cc1 |
| InChI | InChI=1S/C19H18ClNOS/c1-2-3-6-13-9-11-14(12-10-13)21-19(22)18-17(20)15-7-4-5-8-16(15)23-18/h4-5,7-12H,2-3,6H2,1H3,(H,21,22) |
| InChIKey | BLSMPDYGOYCCEO-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.88 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |