C23H19ClN2O3S2 — CID 3312445
3-chloro-N-[4-(2-phenylethylsulfamoyl)phenyl]-1-benzothiophene-2-carboxamide (PubChem CID 3312445) has the molecular formula C23H19ClN2O3S2 and a molecular weight of 471.00 g/mol. Its IUPAC name is 3-chloro-N-[4-(2-phenylethylsulfamoyl)phenyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[4-(2-phenylethylsulfamoyl)phenyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 3312445 |
| Molecular Formula | C23H19ClN2O3S2 |
| Molecular Weight | 471.00 g/mol |
| Exact Mass | 470.05 |
| IUPAC Name | 3-chloro-N-[4-(2-phenylethylsulfamoyl)phenyl]-1-benzothiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)NCCc2ccccc2)cc1)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C23H19ClN2O3S2/c24-21-19-8-4-5-9-20(19)30-22(21)23(27)26-17-10-12-18(13-11-17)31(28,29)25-15-14-16-6-2-1-3-7-16/h1-13,25H,14-15H2,(H,26,27) |
| InChIKey | VJYNZVQJYOMEGM-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.00 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |