C21H19BrN2O3S — CID 5049971
4-bromo-N-[4-(2-phenylethylsulfamoyl)phenyl]benzamide (PubChem CID 5049971) has the molecular formula C21H19BrN2O3S and a molecular weight of 459.37 g/mol. Its IUPAC name is 4-bromo-N-[4-(2-phenylethylsulfamoyl)phenyl]benzamide.
| Compound Name | 4-bromo-N-[4-(2-phenylethylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 5049971 |
| Molecular Formula | C21H19BrN2O3S |
| Molecular Weight | 459.37 g/mol |
| Exact Mass | 458.03 |
| IUPAC Name | 4-bromo-N-[4-(2-phenylethylsulfamoyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)NCCc2ccccc2)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H19BrN2O3S/c22-18-8-6-17(7-9-18)21(25)24-19-10-12-20(13-11-19)28(26,27)23-15-14-16-4-2-1-3-5-16/h1-13,23H,14-15H2,(H,24,25) |
| InChIKey | UXCCKONOSCATSJ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.37 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |