C23H24BrN3O5S2 — CID 17192480
3-[(4-bromophenyl)sulfonylamino]-N-[4-(2-phenylethylsulfamoyl)phenyl]propanamide (PubChem CID 17192480) has the molecular formula C23H24BrN3O5S2 and a molecular weight of 566.50 g/mol. Its IUPAC name is 3-[(4-bromophenyl)sulfonylamino]-N-[4-(2-phenylethylsulfamoyl)phenyl]propanamide.
| Compound Name | 3-[(4-bromophenyl)sulfonylamino]-N-[4-(2-phenylethylsulfamoyl)phenyl]propanamide |
|---|---|
| PubChem CID | 17192480 |
| Molecular Formula | C23H24BrN3O5S2 |
| Molecular Weight | 566.50 g/mol |
| Exact Mass | 565.03 |
| IUPAC Name | 3-[(4-bromophenyl)sulfonylamino]-N-[4-(2-phenylethylsulfamoyl)phenyl]propanamide |
| SMILES | O=C(CCNS(=O)(=O)c1ccc(Br)cc1)Nc1ccc(S(=O)(=O)NCCc2ccccc2)cc1 |
| InChI | InChI=1S/C23H24BrN3O5S2/c24-19-6-10-21(11-7-19)33(29,30)26-17-15-23(28)27-20-8-12-22(13-9-20)34(31,32)25-16-14-18-4-2-1-3-5-18/h1-13,25-26H,14-17H2,(H,27,28) |
| InChIKey | UKTMPLWIUGYJOI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.50 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |