C25H28N2O3S — CID 3595428
4-tert-butyl-N-[4-(2-phenylethylsulfamoyl)phenyl]benzamide (PubChem CID 3595428) has the molecular formula C25H28N2O3S and a molecular weight of 436.58 g/mol. Its IUPAC name is 4-tert-butyl-N-[4-(2-phenylethylsulfamoyl)phenyl]benzamide.
| Compound Name | 4-tert-butyl-N-[4-(2-phenylethylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 3595428 |
| Molecular Formula | C25H28N2O3S |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 4-tert-butyl-N-[4-(2-phenylethylsulfamoyl)phenyl]benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2ccc(S(=O)(=O)NCCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C25H28N2O3S/c1-25(2,3)21-11-9-20(10-12-21)24(28)27-22-13-15-23(16-14-22)31(29,30)26-18-17-19-7-5-4-6-8-19/h4-16,26H,17-18H2,1-3H3,(H,27,28) |
| InChIKey | VJSBFBCIMVJILB-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |