C34H30N4O6S2 — CID 4929117
1-N,4-N-bis[4-(benzylsulfamoyl)phenyl]benzene-1,4-dicarboxamide (PubChem CID 4929117) has the molecular formula C34H30N4O6S2 and a molecular weight of 654.77 g/mol. Its IUPAC name is 1-N,4-N-bis[4-(benzylsulfamoyl)phenyl]benzene-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis[4-(benzylsulfamoyl)phenyl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 4929117 |
| Molecular Formula | C34H30N4O6S2 |
| Molecular Weight | 654.77 g/mol |
| Exact Mass | 654.16 |
| IUPAC Name | 1-N,4-N-bis[4-(benzylsulfamoyl)phenyl]benzene-1,4-dicarboxamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)NCc2ccccc2)cc1)c1ccc(C(=O)Nc2ccc(S(=O)(=O)NCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C34H30N4O6S2/c39-33(37-29-15-19-31(20-16-29)45(41,42)35-23-25-7-3-1-4-8-25)27-11-13-28(14-12-27)34(40)38-30-17-21-32(22-18-30)46(43,44)36-24-26-9-5-2-6-10-26/h1-22,35-36H,23-24H2,(H,37,39)(H,38,40) |
| InChIKey | HWWCEFYZDFLJIJ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 150.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.77 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |