C26H21ClN2O3S — CID 46385848
4-[4-(benzylsulfamoyl)phenyl]-N-(3-chlorophenyl)benzamide (PubChem CID 46385848) has the molecular formula C26H21ClN2O3S and a molecular weight of 476.99 g/mol. Its IUPAC name is 4-[4-(benzylsulfamoyl)phenyl]-N-(3-chlorophenyl)benzamide.
| Compound Name | 4-[4-(benzylsulfamoyl)phenyl]-N-(3-chlorophenyl)benzamide |
|---|---|
| PubChem CID | 46385848 |
| Molecular Formula | C26H21ClN2O3S |
| Molecular Weight | 476.99 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | 4-[4-(benzylsulfamoyl)phenyl]-N-(3-chlorophenyl)benzamide |
| SMILES | O=C(Nc1cccc(Cl)c1)c1ccc(-c2ccc(S(=O)(=O)NCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C26H21ClN2O3S/c27-23-7-4-8-24(17-23)29-26(30)22-11-9-20(10-12-22)21-13-15-25(16-14-21)33(31,32)28-18-19-5-2-1-3-6-19/h1-17,28H,18H2,(H,29,30) |
| InChIKey | OPDSRMFVTATXEQ-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.99 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |