C42H36N2O2 — CID 155202146
N-[3-(2-phenylethyl)phenyl]-4-[4-[[3-(2-phenylethyl)phenyl]carbamoyl]phenyl]benzamide (PubChem CID 155202146) has the molecular formula C42H36N2O2 and a molecular weight of 600.76 g/mol. Its IUPAC name is N-[3-(2-phenylethyl)phenyl]-4-[4-[[3-(2-phenylethyl)phenyl]carbamoyl]phenyl]benzamide.
| Compound Name | N-[3-(2-phenylethyl)phenyl]-4-[4-[[3-(2-phenylethyl)phenyl]carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 155202146 |
| Molecular Formula | C42H36N2O2 |
| Molecular Weight | 600.76 g/mol |
| Exact Mass | 600.28 |
| IUPAC Name | N-[3-(2-phenylethyl)phenyl]-4-[4-[[3-(2-phenylethyl)phenyl]carbamoyl]phenyl]benzamide |
| SMILES | O=C(Nc1cccc(CCc2ccccc2)c1)c1ccc(-c2ccc(C(=O)Nc3cccc(CCc4ccccc4)c3)cc2)cc1 |
| InChI | InChI=1S/C42H36N2O2/c45-41(43-39-15-7-13-33(29-39)19-17-31-9-3-1-4-10-31)37-25-21-35(22-26-37)36-23-27-38(28-24-36)42(46)44-40-16-8-14-34(30-40)20-18-32-11-5-2-6-12-32/h1-16,21-30H,17-20H2,(H,43,45)(H,44,46) |
| InChIKey | KUJXZOQBWDJKQF-UHFFFAOYSA-N |
| XLogP | 9.43 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.76 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |