C23H18ClNO2S — CID 154375130
N-[4-[2-(4-chlorophenyl)ethyl]phenyl]-3-hydroxy-1-benzothiophene-2-carboxamide (PubChem CID 154375130) has the molecular formula C23H18ClNO2S and a molecular weight of 407.92 g/mol. Its IUPAC name is N-[4-[2-(4-chlorophenyl)ethyl]phenyl]-3-hydroxy-1-benzothiophene-2-carboxamide.
| Compound Name | N-[4-[2-(4-chlorophenyl)ethyl]phenyl]-3-hydroxy-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 154375130 |
| Molecular Formula | C23H18ClNO2S |
| Molecular Weight | 407.92 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | N-[4-[2-(4-chlorophenyl)ethyl]phenyl]-3-hydroxy-1-benzothiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc(CCc2ccc(Cl)cc2)cc1)c1sc2ccccc2c1O |
| InChI | InChI=1S/C23H18ClNO2S/c24-17-11-7-15(8-12-17)5-6-16-9-13-18(14-10-16)25-23(27)22-21(26)19-3-1-2-4-20(19)28-22/h1-4,7-14,26H,5-6H2,(H,25,27) |
| InChIKey | KYRILTAEOXIVGY-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.92 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|