C25H22ClNO2S — CID 110500920
N-[4-[(4-chlorophenyl)methoxy]phenyl]-3-propyl-1-benzothiophene-2-carboxamide (PubChem CID 110500920) has the molecular formula C25H22ClNO2S and a molecular weight of 435.98 g/mol. Its IUPAC name is N-[4-[(4-chlorophenyl)methoxy]phenyl]-3-propyl-1-benzothiophene-2-carboxamide.
| Compound Name | N-[4-[(4-chlorophenyl)methoxy]phenyl]-3-propyl-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 110500920 |
| Molecular Formula | C25H22ClNO2S |
| Molecular Weight | 435.98 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | N-[4-[(4-chlorophenyl)methoxy]phenyl]-3-propyl-1-benzothiophene-2-carboxamide |
| SMILES | CCCc1c(C(=O)Nc2ccc(OCc3ccc(Cl)cc3)cc2)sc2ccccc12 |
| InChI | InChI=1S/C25H22ClNO2S/c1-2-5-22-21-6-3-4-7-23(21)30-24(22)25(28)27-19-12-14-20(15-13-19)29-16-17-8-10-18(26)11-9-17/h3-4,6-15H,2,5,16H2,1H3,(H,27,28) |
| InChIKey | KWTVYWXIGLOJNK-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.98 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |