C26H24ClNO3S2 — CID 110503357
ethyl 4-(4-chlorophenyl)-5-methyl-2-[(3-propyl-1-benzothiophene-2-carbonyl)amino]thiophene-3-carboxylate (PubChem CID 110503357) has the molecular formula C26H24ClNO3S2 and a molecular weight of 498.07 g/mol. Its IUPAC name is ethyl 4-(4-chlorophenyl)-5-methyl-2-[(3-propyl-1-benzothiophene-2-carbonyl)amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-(4-chlorophenyl)-5-methyl-2-[(3-propyl-1-benzothiophene-2-carbonyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 110503357 |
| Molecular Formula | C26H24ClNO3S2 |
| Molecular Weight | 498.07 g/mol |
| Exact Mass | 497.09 |
| IUPAC Name | ethyl 4-(4-chlorophenyl)-5-methyl-2-[(3-propyl-1-benzothiophene-2-carbonyl)amino]thiophene-3-carboxylate |
| SMILES | CCCc1c(C(=O)Nc2sc(C)c(-c3ccc(Cl)cc3)c2C(=O)OCC)sc2ccccc12 |
| InChI | InChI=1S/C26H24ClNO3S2/c1-4-8-19-18-9-6-7-10-20(18)33-23(19)24(29)28-25-22(26(30)31-5-2)21(15(3)32-25)16-11-13-17(27)14-12-16/h6-7,9-14H,4-5,8H2,1-3H3,(H,28,29) |
| InChIKey | GSQDSNYUMZAZKN-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.07 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|