C19H19NO3S2 — CID 110503326
methyl 5-methyl-2-[(3-propyl-1-benzothiophene-2-carbonyl)amino]thiophene-3-carboxylate (PubChem CID 110503326) has the molecular formula C19H19NO3S2 and a molecular weight of 373.50 g/mol. Its IUPAC name is methyl 5-methyl-2-[(3-propyl-1-benzothiophene-2-carbonyl)amino]thiophene-3-carboxylate.
| Compound Name | methyl 5-methyl-2-[(3-propyl-1-benzothiophene-2-carbonyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 110503326 |
| Molecular Formula | C19H19NO3S2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | methyl 5-methyl-2-[(3-propyl-1-benzothiophene-2-carbonyl)amino]thiophene-3-carboxylate |
| SMILES | CCCc1c(C(=O)Nc2sc(C)cc2C(=O)OC)sc2ccccc12 |
| InChI | InChI=1S/C19H19NO3S2/c1-4-7-13-12-8-5-6-9-15(12)25-16(13)17(21)20-18-14(19(22)23-3)10-11(2)24-18/h5-6,8-10H,4,7H2,1-3H3,(H,20,21) |
| InChIKey | LLZXSZJWPHJFFM-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |