C18H23NOS — CID 110497075
N-cyclohexyl-3-propyl-1-benzothiophene-2-carboxamide (PubChem CID 110497075) has the molecular formula C18H23NOS and a molecular weight of 301.45 g/mol. Its IUPAC name is N-cyclohexyl-3-propyl-1-benzothiophene-2-carboxamide.
| Compound Name | N-cyclohexyl-3-propyl-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 110497075 |
| Molecular Formula | C18H23NOS |
| Molecular Weight | 301.45 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | N-cyclohexyl-3-propyl-1-benzothiophene-2-carboxamide |
| SMILES | CCCc1c(C(=O)NC2CCCCC2)sc2ccccc12 |
| InChI | InChI=1S/C18H23NOS/c1-2-8-15-14-11-6-7-12-16(14)21-17(15)18(20)19-13-9-4-3-5-10-13/h6-7,11-13H,2-5,8-10H2,1H3,(H,19,20) |
| InChIKey | OIKBLTFNYXZCEL-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.45 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |